C13H22NO3S+ — CID 6713455
4-methylbenzenesulfonic acid;trimethyl(prop-2-enyl)azanium (PubChem CID 6713455) has the molecular formula C13H22NO3S+ and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;trimethyl(prop-2-enyl)azanium.
| Compound Name | 4-methylbenzenesulfonic acid;trimethyl(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 6713455 |
| Molecular Formula | C13H22NO3S+ |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-methylbenzenesulfonic acid;trimethyl(prop-2-enyl)azanium |
| SMILES | C=CC[N+](C)(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H14N/c1-6-2-4-7(5-3-6)11(8,9)10;1-5-6-7(2,3)4/h2-5H,1H3,(H,8,9,10);5H,1,6H2,2-4H3/q;+1 |
| InChIKey | UIOGHEKXNBIEIQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|