About bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine
bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine (PubChem CID 134983822) has the molecular formula C17H24N2O6S2
and a molecular weight of 416.52 g/mol. Its IUPAC name is bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine.
Molecular Properties
| Compound Name | bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine |
| PubChem CID | 134983822 |
| Molecular Formula | C17H24N2O6S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine |
| SMILES | C=CCNN.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/2C7H8O3S.C3H8N2/c2*1-6-2-4-7(5-3-6)11(8,9)10;1-2-3-5-4/h2*2-5H,1H3,(H,8,9,10);2,5H,1,3-4H2 |
| InChIKey | BFSSBFABRQDHFM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine?
The IUPAC name of bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine (CID 134983822) is bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine.
What is the SMILES notation for bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine?
The canonical SMILES for bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine is C=CCNN.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine?
The InChIKey is BFSSBFABRQDHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O3S.C3H8N2/c2*1-6-2-4-7(5-3-6)11(8,9)10;1-2-3-5-4/h2*2-5H,1H3,(H,8,9,10);2,5H,1,3-4H2.
What are the key properties of bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine?
bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine has a molecular weight of 416.52 g/mol, XLogP of 2.12, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylbenzenesulfonic acid);prop-2-enylhydrazine is sourced from PubChem (CID 134983822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).