C15H30ClNO2 — CID 139894451
dimethyl-(2-methylprop-2-enoyloxymethyl)-octylazanium chloride (PubChem CID 139894451) has the molecular formula C15H30ClNO2 and a molecular weight of 291.86 g/mol. Its IUPAC name is dimethyl-(2-methylprop-2-enoyloxymethyl)-octylazanium chloride.
| Compound Name | dimethyl-(2-methylprop-2-enoyloxymethyl)-octylazanium chloride |
|---|---|
| PubChem CID | 139894451 |
| Molecular Formula | C15H30ClNO2 |
| Molecular Weight | 291.86 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | dimethyl-(2-methylprop-2-enoyloxymethyl)-octylazanium chloride |
| SMILES | C=C(C)C(=O)OC[N+](C)(C)CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C15H30NO2.ClH/c1-6-7-8-9-10-11-12-16(4,5)13-18-15(17)14(2)3;/h2,6-13H2,1,3-5H3;1H/q+1;/p-1 |
| InChIKey | LVOGTTVDQVCZEV-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.86 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|