C11H23ClNO2+ — CID 19391993
chloroethane;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 19391993) has the molecular formula C11H23ClNO2+ and a molecular weight of 236.76 g/mol. Its IUPAC name is chloroethane;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | chloroethane;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 19391993 |
| Molecular Formula | C11H23ClNO2+ |
| Molecular Weight | 236.76 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | chloroethane;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)C.CCCl |
| InChI | InChI=1S/C9H18NO2.C2H5Cl/c1-8(2)9(11)12-7-6-10(3,4)5;1-2-3/h1,6-7H2,2-5H3;2H2,1H3/q+1; |
| InChIKey | LDOSJUFIXIDEBG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|