C13H24O2 — CID 88557517
2,5,5-trimethylhexan-2-yl 2-methylprop-2-enoate (PubChem CID 88557517) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,5,5-trimethylhexan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2,5,5-trimethylhexan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88557517 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,5,5-trimethylhexan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C13H24O2/c1-10(2)11(14)15-13(6,7)9-8-12(3,4)5/h1,8-9H2,2-7H3 |
| InChIKey | ZLEJUTBTINZULQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|