C17H28O4 — CID 22259481
[7-methyl-7-(2-methylprop-2-enoyloxy)octan-2-yl] 2-methylprop-2-enoate (PubChem CID 22259481) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [7-methyl-7-(2-methylprop-2-enoyloxy)octan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [7-methyl-7-(2-methylprop-2-enoyloxy)octan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22259481 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [7-methyl-7-(2-methylprop-2-enoyloxy)octan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CCCCC(C)(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H28O4/c1-12(2)15(18)20-14(5)10-8-9-11-17(6,7)21-16(19)13(3)4/h14H,1,3,8-11H2,2,4-7H3 |
| InChIKey | XGOJJSUFNMOLSV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|