C17H24O6 — CID 142750800
[2-methyl-3,3-bis(2-methylprop-2-enoyloxy)butan-2-yl] 2-methylprop-2-enoate (PubChem CID 142750800) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [2-methyl-3,3-bis(2-methylprop-2-enoyloxy)butan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-3,3-bis(2-methylprop-2-enoyloxy)butan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142750800 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [2-methyl-3,3-bis(2-methylprop-2-enoyloxy)butan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C(C)(OC(=O)C(=C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H24O6/c1-10(2)13(18)21-16(7,8)17(9,22-14(19)11(3)4)23-15(20)12(5)6/h1,3,5H2,2,4,6-9H3 |
| InChIKey | OOLVXAHMEZKXQJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|