(1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate

C10H20O4Si — CID 174362709

IUPAC(1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC([SiH3])(OC)C(C)(C)OC
InChIInChI=1S/C10H20O4Si/c1-7(2)8(11)14-10(15,13-6)9(3,4)12-5/h1H2,2-6,15H3
InChIKeyDSWKVSNIICZWQE-UHFFFAOYSA-N
MW232.35 g/mol
LogP0.20
Rot. Bonds5

About (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate

(1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate (PubChem CID 174362709) has the molecular formula C10H20O4Si and a molecular weight of 232.35 g/mol. Its IUPAC name is (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate.

Molecular Properties

Compound Name(1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate
PubChem CID174362709
Molecular FormulaC10H20O4Si
Molecular Weight232.35 g/mol
Exact Mass232.11
IUPAC Name(1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC([SiH3])(OC)C(C)(C)OC
InChIInChI=1S/C10H20O4Si/c1-7(2)8(11)14-10(15,13-6)9(3,4)12-5/h1H2,2-6,15H3
InChIKeyDSWKVSNIICZWQE-UHFFFAOYSA-N
XLogP0.20
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.35
LogP ≤ 50.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate?
The IUPAC name of (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate (CID 174362709) is (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate.
What is the SMILES notation for (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate?
The canonical SMILES for (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate is C=C(C)C(=O)OC([SiH3])(OC)C(C)(C)OC.
What is the InChIKey of (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate?
The InChIKey is DSWKVSNIICZWQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4Si/c1-7(2)8(11)14-10(15,13-6)9(3,4)12-5/h1H2,2-6,15H3.
What are the key properties of (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate?
(1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate has a molecular weight of 232.35 g/mol, XLogP of 0.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethoxy-2-methyl-1-silylpropyl) 2-methylprop-2-enoate is sourced from PubChem (CID 174362709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).