C17H26O5 — CID 139852007
[2,6-dimethyl-6-(2-methylprop-2-enoyloxy)-4-oxoheptan-2-yl] 2-methylprop-2-enoate (PubChem CID 139852007) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [2,6-dimethyl-6-(2-methylprop-2-enoyloxy)-4-oxoheptan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2,6-dimethyl-6-(2-methylprop-2-enoyloxy)-4-oxoheptan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139852007 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [2,6-dimethyl-6-(2-methylprop-2-enoyloxy)-4-oxoheptan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CC(=O)CC(C)(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H26O5/c1-11(2)14(19)21-16(5,6)9-13(18)10-17(7,8)22-15(20)12(3)4/h1,3,9-10H2,2,4-8H3 |
| InChIKey | LKHOMSYIMUZQBQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|