C12H20O4 — CID 88579591
2,2,4-trimethyl-4-(2-methylprop-2-enoyloxy)pentanoic acid (PubChem CID 88579591) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(2-methylprop-2-enoyloxy)pentanoic acid.
| Compound Name | 2,2,4-trimethyl-4-(2-methylprop-2-enoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 88579591 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2,2,4-trimethyl-4-(2-methylprop-2-enoyloxy)pentanoic acid |
| SMILES | C=C(C)C(=O)OC(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C12H20O4/c1-8(2)9(13)16-12(5,6)7-11(3,4)10(14)15/h1,7H2,2-6H3,(H,14,15) |
| InChIKey | FVZKAUSJAWXTCR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|