C18H26O9 — CID 172736329
[4-hydroxy-3,3-bis(hydroxymethyl)-1,1-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate (PubChem CID 172736329) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is [4-hydroxy-3,3-bis(hydroxymethyl)-1,1-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate.
| Compound Name | [4-hydroxy-3,3-bis(hydroxymethyl)-1,1-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172736329 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [4-hydroxy-3,3-bis(hydroxymethyl)-1,1-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC(CO)(CO)CO)(OC(=O)C(=C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C18H26O9/c1-11(2)14(22)25-18(26-15(23)12(3)4,27-16(24)13(5)6)7-17(8-19,9-20)10-21/h19-21H,1,3,5,7-10H2,2,4,6H3 |
| InChIKey | IMJVVSRSZSJZEX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|