C10H18O5 — CID 22174301
[1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutan-2-yl] 2-methylprop-2-enoate (PubChem CID 22174301) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is [1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22174301 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CO)(CO)C(C)CO |
| InChI | InChI=1S/C10H18O5/c1-7(2)9(14)15-10(5-12,6-13)8(3)4-11/h8,11-13H,1,4-6H2,2-3H3 |
| InChIKey | JZFNFDWQFTXNCI-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|