C19H32O6 — CID 153344762
[1-hydroxy-4-(hydroxymethyl)-5-methyl-1-(2-methylprop-2-enoyloxy)-4-propan-2-ylhexyl] 2-methylprop-2-enoate (PubChem CID 153344762) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is [1-hydroxy-4-(hydroxymethyl)-5-methyl-1-(2-methylprop-2-enoyloxy)-4-propan-2-ylhexyl] 2-methylprop-2-enoate.
| Compound Name | [1-hydroxy-4-(hydroxymethyl)-5-methyl-1-(2-methylprop-2-enoyloxy)-4-propan-2-ylhexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153344762 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [1-hydroxy-4-(hydroxymethyl)-5-methyl-1-(2-methylprop-2-enoyloxy)-4-propan-2-ylhexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(O)(CCC(CO)(C(C)C)C(C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C19H32O6/c1-12(2)16(21)24-19(23,25-17(22)13(3)4)10-9-18(11-20,14(5)6)15(7)8/h14-15,20,23H,1,3,9-11H2,2,4-8H3 |
| InChIKey | MVQXJSBQSWDXCV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|