C18H26O10 — CID 139612104
[3,4-dihydroxy-2,3-bis(hydroxymethyl)-1,2-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate (PubChem CID 139612104) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is [3,4-dihydroxy-2,3-bis(hydroxymethyl)-1,2-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate.
| Compound Name | [3,4-dihydroxy-2,3-bis(hydroxymethyl)-1,2-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139612104 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [3,4-dihydroxy-2,3-bis(hydroxymethyl)-1,2-bis(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OC(=O)C(=C)C)C(CO)(OC(=O)C(=C)C)C(O)(CO)CO |
| InChI | InChI=1S/C18H26O10/c1-10(2)13(22)26-16(27-14(23)11(3)4)18(9-21,17(25,7-19)8-20)28-15(24)12(5)6/h16,19-21,25H,1,3,5,7-9H2,2,4,6H3 |
| InChIKey | YLSOLUABWSHBIE-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|