C25H38O12 — CID 88603957
2,2-bis(hydroxymethyl)propane-1,3-diol;[(2R,3S)-2,3,4-tris(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate (PubChem CID 88603957) has the molecular formula C25H38O12 and a molecular weight of 530.57 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;[(2R,3S)-2,3,4-tris(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;[(2R,3S)-2,3,4-tris(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88603957 |
| Molecular Formula | C25H38O12 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;[(2R,3S)-2,3,4-tris(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@H](OC(=O)C(=C)C)[C@@H](COC(=O)C(=C)C)OC(=O)C(=C)C.OCC(CO)(CO)CO |
| InChI | InChI=1S/C20H26O8.C5H12O4/c1-11(2)17(21)25-9-15(27-19(23)13(5)6)16(28-20(24)14(7)8)10-26-18(22)12(3)4;6-1-5(2-7,3-8)4-9/h15-16H,1,3,5,7,9-10H2,2,4,6,8H3;6-9H,1-4H2/t15-,16+; |
| InChIKey | AXISYMPXWMLGHG-FAESNJTISA-N |
| XLogP | 0.14 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|