C18H24O9 — CID 87395741
[(2R,3S,4R,5R)-4,5-dihydroxy-2,3-bis(2-methylprop-2-enoyloxy)-6-oxohexyl] 2-methylprop-2-enoate (PubChem CID 87395741) has the molecular formula C18H24O9 and a molecular weight of 384.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4,5-dihydroxy-2,3-bis(2-methylprop-2-enoyloxy)-6-oxohexyl] 2-methylprop-2-enoate.
| Compound Name | [(2R,3S,4R,5R)-4,5-dihydroxy-2,3-bis(2-methylprop-2-enoyloxy)-6-oxohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87395741 |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [(2R,3S,4R,5R)-4,5-dihydroxy-2,3-bis(2-methylprop-2-enoyloxy)-6-oxohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@@H](OC(=O)C(=C)C)[C@@H](OC(=O)C(=C)C)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C18H24O9/c1-9(2)16(22)25-8-13(26-17(23)10(3)4)15(14(21)12(20)7-19)27-18(24)11(5)6/h7,12-15,20-21H,1,3,5,8H2,2,4,6H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | FWJLEZPKBDHEMF-GBJTYRQASA-N |
| XLogP | 0.00 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|