C12H16O10 — CID 57346805
[(2R,3S,4R,5R)-2,4,5-trihydroxy-6-oxo-3-(2-oxopropanoyloxy)hexyl] 2-oxopropanoate (PubChem CID 57346805) has the molecular formula C12H16O10 and a molecular weight of 320.25 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,4,5-trihydroxy-6-oxo-3-(2-oxopropanoyloxy)hexyl] 2-oxopropanoate.
| Compound Name | [(2R,3S,4R,5R)-2,4,5-trihydroxy-6-oxo-3-(2-oxopropanoyloxy)hexyl] 2-oxopropanoate |
|---|---|
| PubChem CID | 57346805 |
| Molecular Formula | C12H16O10 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | [(2R,3S,4R,5R)-2,4,5-trihydroxy-6-oxo-3-(2-oxopropanoyloxy)hexyl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC[C@@H](O)[C@H](OC(=O)C(C)=O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C12H16O10/c1-5(14)11(19)21-4-8(17)10(9(18)7(16)3-13)22-12(20)6(2)15/h3,7-10,16-18H,4H2,1-2H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | JJUONCSWUJTFLL-JLIMGVALSA-N |
| XLogP | -3.10 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|