C7H12O8 — CID 87133992
[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen carbonate (PubChem CID 87133992) has the molecular formula C7H12O8 and a molecular weight of 224.16 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen carbonate.
| Compound Name | [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 87133992 |
| Molecular Formula | C7H12O8 |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen carbonate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)COC(=O)O |
| InChI | InChI=1S/C7H12O8/c8-1-3(9)5(11)6(12)4(10)2-15-7(13)14/h1,3-6,9-12H,2H2,(H,13,14)/t3-,4+,5+,6-/m0/s1 |
| InChIKey | ZAOHHYZBLVRXNQ-KCDKBNATSA-N |
| XLogP | -2.68 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|