C6H14NO7P — CID 87647678
[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]phosphonamidous acid (PubChem CID 87647678) has the molecular formula C6H14NO7P and a molecular weight of 243.15 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]phosphonamidous acid.
| Compound Name | [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]phosphonamidous acid |
|---|---|
| PubChem CID | 87647678 |
| Molecular Formula | C6H14NO7P |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | [(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]phosphonamidous acid |
| SMILES | NP(O)OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C6H14NO7P/c7-15(13)14-2-4(10)6(12)5(11)3(9)1-8/h1,3-6,9-13H,2,7H2/t3-,4+,5+,6-,15?/m0/s1 |
| InChIKey | HZYXBFHVNPLXGC-ZRAGXMNUSA-N |
| XLogP | -3.18 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|