C9H14O8 — CID 22871600
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 2-oxopropanoate (PubChem CID 22871600) has the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 2-oxopropanoate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 2-oxopropanoate |
|---|---|
| PubChem CID | 22871600 |
| Molecular Formula | C9H14O8 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C9H14O8/c1-4(11)9(16)17-3-6(13)8(15)7(14)5(12)2-10/h2,5-8,12-15H,3H2,1H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | YJZHBDXDNRNHFF-LXGUWJNJSA-N |
| XLogP | -3.24 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|