C13H24O9 — CID 87698654
butanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] propanoate (PubChem CID 87698654) has the molecular formula C13H24O9 and a molecular weight of 324.33 g/mol. Its IUPAC name is butanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] propanoate.
| Compound Name | butanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] propanoate |
|---|---|
| PubChem CID | 87698654 |
| Molecular Formula | C13H24O9 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | butanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] propanoate |
| SMILES | CCC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O.CCCC(=O)O |
| InChI | InChI=1S/C9H16O7.C4H8O2/c1-2-7(13)16-4-6(12)9(15)8(14)5(11)3-10;1-2-3-4(5)6/h3,5-6,8-9,11-12,14-15H,2,4H2,1H3;2-3H2,1H3,(H,5,6)/t5-,6+,8+,9+;/m0./s1 |
| InChIKey | JTVHLBXVPAHPRT-SEXLINGPSA-N |
| XLogP | -1.55 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|