C11H18O9 — CID 163029223
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] (3S)-3,4-dihydroxy-2-methylidenebutanoate (PubChem CID 163029223) has the molecular formula C11H18O9 and a molecular weight of 294.26 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] (3S)-3,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] (3S)-3,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 163029223 |
| Molecular Formula | C11H18O9 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] (3S)-3,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)[C@H](O)CO |
| InChI | InChI=1S/C11H18O9/c1-5(6(14)2-12)11(19)20-4-8(16)10(18)9(17)7(15)3-13/h3,6-10,12,14-18H,1-2,4H2/t6-,7+,8-,9-,10-/m1/s1 |
| InChIKey | MDHZAFUATLVBMS-JDDHQFAOSA-N |
| XLogP | -3.92 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|