C12H22O11 — CID 158552772
2,3-dihydroxypropyl 2-oxopropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 158552772) has the molecular formula C12H22O11 and a molecular weight of 342.30 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-oxopropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2,3-dihydroxypropyl 2-oxopropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 158552772 |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,3-dihydroxypropyl 2-oxopropanoate;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CC(=O)C(=O)OCC(O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C6H10O5/c7-1-3(9)5(11)6(12)4(10)2-8;1-4(8)6(10)11-3-5(9)2-7/h1,3-6,8-12H,2H2;5,7,9H,2-3H2,1H3/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | HPXSNQDAJWULDR-BTVCFUMJSA-N |
| XLogP | -4.91 |
| TPSA | 202.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|