C9H20O9 — CID 87178496
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propane-1,2,3-triol (PubChem CID 87178496) has the molecular formula C9H20O9 and a molecular weight of 272.25 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propane-1,2,3-triol.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87178496 |
| Molecular Formula | C9H20O9 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propane-1,2,3-triol |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OCC(O)CO |
| InChI | InChI=1S/C6H12O6.C3H8O3/c7-1-3(9)5(11)6(12)4(10)2-8;4-1-3(6)2-5/h1,3-6,8-12H,2H2;3-6H,1-2H2/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | VEMLQICWTSVKQH-BTVCFUMJSA-N |
| XLogP | -5.05 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|