C13H30O13 — CID 134284179
(2S,4R)-pentane-1,2,3,4,5-pentol;propane-1,2,3-triol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 134284179) has the molecular formula C13H30O13 and a molecular weight of 394.37 g/mol. Its IUPAC name is (2S,4R)-pentane-1,2,3,4,5-pentol;propane-1,2,3-triol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (2S,4R)-pentane-1,2,3,4,5-pentol;propane-1,2,3-triol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 134284179 |
| Molecular Formula | C13H30O13 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (2S,4R)-pentane-1,2,3,4,5-pentol;propane-1,2,3-triol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)CO.OCC(O)CO.OC[C@@H](O)C(O)[C@@H](O)CO |
| InChI | InChI=1S/C5H12O5.C5H10O5.C3H8O3/c2*6-1-3(8)5(10)4(9)2-7;4-1-3(6)2-5/h3-10H,1-2H2;1,3-5,7-10H,2H2;3-6H,1-2H2/t3-,4+,5?;3-,4+,5+;/m.0./s1 |
| InChIKey | NLHMOPNHUGCRJR-FMTJWRRRSA-N |
| XLogP | -7.35 |
| TPSA | 259.83 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | -7.35 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|