C12H28O11 — CID 88521604
ethanol;(2S,4R)-pentane-1,2,3,4,5-pentol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 88521604) has the molecular formula C12H28O11 and a molecular weight of 348.35 g/mol. Its IUPAC name is ethanol;(2S,4R)-pentane-1,2,3,4,5-pentol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | ethanol;(2S,4R)-pentane-1,2,3,4,5-pentol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 88521604 |
| Molecular Formula | C12H28O11 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | ethanol;(2S,4R)-pentane-1,2,3,4,5-pentol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | CCO.O=C[C@H](O)[C@@H](O)[C@H](O)CO.OC[C@@H](O)C(O)[C@@H](O)CO |
| InChI | InChI=1S/C5H12O5.C5H10O5.C2H6O/c2*6-1-3(8)5(10)4(9)2-7;1-2-3/h3-10H,1-2H2;1,3-5,7-10H,2H2;3H,2H2,1H3/t3-,4+,5?;3-,4+,5+;/m.0./s1 |
| InChIKey | ICMUOVLRDNVVSE-FMTJWRRRSA-N |
| XLogP | -5.69 |
| TPSA | 219.37 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -5.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|