C9H22O5S2 — CID 87528291
ethanethiol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 87528291) has the molecular formula C9H22O5S2 and a molecular weight of 274.40 g/mol. Its IUPAC name is ethanethiol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | ethanethiol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 87528291 |
| Molecular Formula | C9H22O5S2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | ethanethiol;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | CCS.CCS.O=C[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H10O5.2C2H6S/c6-1-3(8)5(10)4(9)2-7;2*1-2-3/h1,3-5,7-10H,2H2;2*3H,2H2,1H3/t3-,4+,5+;;/m0../s1 |
| InChIKey | LSVXZARGZIOYDS-GBQQWJQBSA-N |
| XLogP | -0.87 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|