C6H12O6Se — CID 175692412
CID 175692412 (PubChem CID 175692412) has the molecular formula C6H12O6Se and a molecular weight of 259.12 g/mol.
| Compound Name | CID 175692412 |
|---|---|
| PubChem CID | 175692412 |
| Molecular Formula | C6H12O6Se |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | — |
| SMILES | O=C[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CO.[Se] |
| InChI | InChI=1S/C6H12O6.Se/c7-1-3(9)5(11)6(12)4(10)2-8;/h1,3-6,8-12H,2H2;/t3-,4-,5+,6+;/m1./s1 |
| InChIKey | KHZVPOZSUOHZHC-QAYODLCCSA-N |
| XLogP | -3.76 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|