C14H26O14 — CID 88706465
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] acetate (PubChem CID 88706465) has the molecular formula C14H26O14 and a molecular weight of 418.35 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] acetate.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 88706465 |
| Molecular Formula | C14H26O14 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] acetate |
| SMILES | CC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H14O7.C6H12O7/c1-4(10)15-3-6(12)8(14)7(13)5(11)2-9;7-1-2(8)3(9)4(10)5(11)6(12)13/h2,5-8,11-14H,3H2,1H3;2-5,7-11H,1H2,(H,12,13)/t5-,6+,7+,8+;2-,3-,4+,5-/m01/s1 |
| InChIKey | YHDOYHWPRJNBLU-YGBTXBKNSA-N |
| XLogP | -6.30 |
| TPSA | 262.74 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | -6.30 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|