C8H16O7 — CID 54465409
[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl] acetate (PubChem CID 54465409) has the molecular formula C8H16O7 and a molecular weight of 224.21 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl] acetate.
| Compound Name | [(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl] acetate |
|---|---|
| PubChem CID | 54465409 |
| Molecular Formula | C8H16O7 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl] acetate |
| SMILES | CC(=O)OC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O7/c1-4(10)15-3-6(12)8(14)7(13)5(11)2-9/h5-9,11-14H,2-3H2,1H3/t5-,6+,7+,8-/m1/s1 |
| InChIKey | XEMCIUAYUWMMMF-VGRMVHKJSA-N |
| XLogP | -3.01 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |