C7H16MgO8 — CID 173053155
magnesium;hydride;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] hydrogen carbonate (PubChem CID 173053155) has the molecular formula C7H16MgO8 and a molecular weight of 252.50 g/mol. Its IUPAC name is magnesium;hydride;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] hydrogen carbonate.
| Compound Name | magnesium;hydride;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] hydrogen carbonate |
|---|---|
| PubChem CID | 173053155 |
| Molecular Formula | C7H16MgO8 |
| Molecular Weight | 252.50 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | magnesium;hydride;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] hydrogen carbonate |
| SMILES | O=C(O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C7H14O8.Mg.2H/c8-1-3(9)5(11)6(12)4(10)2-15-7(13)14;;;/h3-6,8-12H,1-2H2,(H,13,14);;;/q;+2;2*-1/t3-,4-,5-,6-;;;/m1.../s1 |
| InChIKey | XQUAZUDWNTYRQU-KPGAZFBQSA-N |
| XLogP | -3.04 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.50 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |