C9H18O9 — CID 57194035
2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanoic acid (PubChem CID 57194035) has the molecular formula C9H18O9 and a molecular weight of 270.23 g/mol. Its IUPAC name is 2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanoic acid.
| Compound Name | 2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanoic acid |
|---|---|
| PubChem CID | 57194035 |
| Molecular Formula | C9H18O9 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]propanoic acid |
| SMILES | O=C(O)C(O)COC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O9/c10-1-4(11)7(14)8(15)5(12)2-18-3-6(13)9(16)17/h4-8,10-15H,1-3H2,(H,16,17)/t4-,5+,6?,7-,8-/m1/s1 |
| InChIKey | IMRFXOKYBSYABR-SRLYZFLGSA-N |
| XLogP | -4.12 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |