C7H17O9P — CID 88598237
[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]methylphosphonic acid (PubChem CID 88598237) has the molecular formula C7H17O9P and a molecular weight of 276.18 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]methylphosphonic acid.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 88598237 |
| Molecular Formula | C7H17O9P |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]methylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H17O9P/c8-1-4(9)6(11)7(12)5(10)2-16-3-17(13,14)15/h4-12H,1-3H2,(H2,13,14,15)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | VWELRURCQCFTPU-DBRKOABJSA-N |
| XLogP | -3.43 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|