C8H18O7 — CID 22287921
6-(2-hydroxyethoxy)hexane-1,2,3,4,5-pentol (PubChem CID 22287921) has the molecular formula C8H18O7 and a molecular weight of 226.22 g/mol. Its IUPAC name is 6-(2-hydroxyethoxy)hexane-1,2,3,4,5-pentol.
| Compound Name | 6-(2-hydroxyethoxy)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 22287921 |
| Molecular Formula | C8H18O7 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 6-(2-hydroxyethoxy)hexane-1,2,3,4,5-pentol |
| SMILES | OCCOCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H18O7/c9-1-2-15-4-6(12)8(14)7(13)5(11)3-10/h5-14H,1-4H2 |
| InChIKey | XVGMUUXDFMGIMI-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|