C12H26O9 — CID 20813425
1,5,6-tris(2-hydroxyethoxy)hexane-2,3,4-triol (PubChem CID 20813425) has the molecular formula C12H26O9 and a molecular weight of 314.33 g/mol. Its IUPAC name is 1,5,6-tris(2-hydroxyethoxy)hexane-2,3,4-triol.
| Compound Name | 1,5,6-tris(2-hydroxyethoxy)hexane-2,3,4-triol |
|---|---|
| PubChem CID | 20813425 |
| Molecular Formula | C12H26O9 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1,5,6-tris(2-hydroxyethoxy)hexane-2,3,4-triol |
| SMILES | OCCOCC(O)C(O)C(O)C(COCCO)OCCO |
| InChI | InChI=1S/C12H26O9/c13-1-4-19-7-9(16)11(17)12(18)10(21-6-3-15)8-20-5-2-14/h9-18H,1-8H2 |
| InChIKey | HBQQEWWIHDQZTD-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|