C10H22O7 — CID 174784846
2-[2-[1,2-bis(2-hydroxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 174784846) has the molecular formula C10H22O7 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-[2-[1,2-bis(2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[1,2-bis(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 174784846 |
| Molecular Formula | C10H22O7 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-[2-[1,2-bis(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOC(COCCO)OCCO |
| InChI | InChI=1S/C10H22O7/c11-1-4-14-7-8-17-10(16-6-3-13)9-15-5-2-12/h10-13H,1-9H2 |
| InChIKey | QAMYZEUGTDORNM-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|