C12H26O4 — CID 57055160
2-(1,2-dibutoxyethoxy)ethanol (PubChem CID 57055160) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(1,2-dibutoxyethoxy)ethanol.
| Compound Name | 2-(1,2-dibutoxyethoxy)ethanol |
|---|---|
| PubChem CID | 57055160 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-(1,2-dibutoxyethoxy)ethanol |
| SMILES | CCCCOCC(OCCO)OCCCC |
| InChI | InChI=1S/C12H26O4/c1-3-5-8-14-11-12(16-10-7-13)15-9-6-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | FANHEEQYCUNCJP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|