C12H28O4Si — CID 123260275
4-(1,2-dipropoxyethoxy)butoxysilane (PubChem CID 123260275) has the molecular formula C12H28O4Si and a molecular weight of 264.44 g/mol. Its IUPAC name is 4-(1,2-dipropoxyethoxy)butoxysilane.
| Compound Name | 4-(1,2-dipropoxyethoxy)butoxysilane |
|---|---|
| PubChem CID | 123260275 |
| Molecular Formula | C12H28O4Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 4-(1,2-dipropoxyethoxy)butoxysilane |
| SMILES | CCCOCC(OCCC)OCCCCO[SiH3] |
| InChI | InChI=1S/C12H28O4Si/c1-3-7-13-11-12(14-8-4-2)15-9-5-6-10-16-17/h12H,3-11H2,1-2,17H3 |
| InChIKey | UCUHYEOYIFOQJW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|