C12H28O3Si — CID 123351057
butyl(1,2-dipropoxyethoxy)silane (PubChem CID 123351057) has the molecular formula C12H28O3Si and a molecular weight of 248.44 g/mol. Its IUPAC name is butyl(1,2-dipropoxyethoxy)silane.
| Compound Name | butyl(1,2-dipropoxyethoxy)silane |
|---|---|
| PubChem CID | 123351057 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | butyl(1,2-dipropoxyethoxy)silane |
| SMILES | CCCC[SiH2]OC(COCCC)OCCC |
| InChI | InChI=1S/C12H28O3Si/c1-4-7-10-16-15-12(14-9-6-3)11-13-8-5-2/h12H,4-11,16H2,1-3H3 |
| InChIKey | CUUWRYIVSADIJJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|