C10H24O3Si — CID 175052836
butyl(1,4-dimethoxybutoxy)silane (PubChem CID 175052836) has the molecular formula C10H24O3Si and a molecular weight of 220.38 g/mol. Its IUPAC name is butyl(1,4-dimethoxybutoxy)silane.
| Compound Name | butyl(1,4-dimethoxybutoxy)silane |
|---|---|
| PubChem CID | 175052836 |
| Molecular Formula | C10H24O3Si |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | butyl(1,4-dimethoxybutoxy)silane |
| SMILES | CCCC[SiH2]OC(CCCOC)OC |
| InChI | InChI=1S/C10H24O3Si/c1-4-5-9-14-13-10(12-3)7-6-8-11-2/h10H,4-9,14H2,1-3H3 |
| InChIKey | ZXDNTKGXGPPXRL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|