C14H30O3Si — CID 123848895
dec-9-enyl(1,2-dimethoxyethoxy)silane (PubChem CID 123848895) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is dec-9-enyl(1,2-dimethoxyethoxy)silane.
| Compound Name | dec-9-enyl(1,2-dimethoxyethoxy)silane |
|---|---|
| PubChem CID | 123848895 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | dec-9-enyl(1,2-dimethoxyethoxy)silane |
| SMILES | C=CCCCCCCCC[SiH2]OC(COC)OC |
| InChI | InChI=1S/C14H30O3Si/c1-4-5-6-7-8-9-10-11-12-18-17-14(16-3)13-15-2/h4,14H,1,5-13,18H2,2-3H3 |
| InChIKey | BNWAONCCEFOEPJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|