C15H34O3Si — CID 174052564
1,2-dimethoxyethoxy(undecyl)silane (PubChem CID 174052564) has the molecular formula C15H34O3Si and a molecular weight of 290.52 g/mol. Its IUPAC name is 1,2-dimethoxyethoxy(undecyl)silane.
| Compound Name | 1,2-dimethoxyethoxy(undecyl)silane |
|---|---|
| PubChem CID | 174052564 |
| Molecular Formula | C15H34O3Si |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | 1,2-dimethoxyethoxy(undecyl)silane |
| SMILES | CCCCCCCCCCC[SiH2]OC(COC)OC |
| InChI | InChI=1S/C15H34O3Si/c1-4-5-6-7-8-9-10-11-12-13-19-18-15(17-3)14-16-2/h15H,4-14,19H2,1-3H3 |
| InChIKey | VCJOLRQTPCAGMY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|