C12H26O3Si — CID 173307774
1,1-dimethoxyethoxy(oct-7-enyl)silane (PubChem CID 173307774) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is 1,1-dimethoxyethoxy(oct-7-enyl)silane.
| Compound Name | 1,1-dimethoxyethoxy(oct-7-enyl)silane |
|---|---|
| PubChem CID | 173307774 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1,1-dimethoxyethoxy(oct-7-enyl)silane |
| SMILES | C=CCCCCCC[SiH2]OC(C)(OC)OC |
| InChI | InChI=1S/C12H26O3Si/c1-5-6-7-8-9-10-11-16-15-12(2,13-3)14-4/h5H,1,6-11,16H2,2-4H3 |
| InChIKey | NWPIAZCMBWLOSX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|