C30H62O9 — CID 175177315
1-[3-[3-(1,5-dipropoxypentoxy)propoxymethoxymethoxy]propoxy]-1,5-dipropoxypentane (PubChem CID 175177315) has the molecular formula C30H62O9 and a molecular weight of 566.82 g/mol. Its IUPAC name is 1-[3-[3-(1,5-dipropoxypentoxy)propoxymethoxymethoxy]propoxy]-1,5-dipropoxypentane.
| Compound Name | 1-[3-[3-(1,5-dipropoxypentoxy)propoxymethoxymethoxy]propoxy]-1,5-dipropoxypentane |
|---|---|
| PubChem CID | 175177315 |
| Molecular Formula | C30H62O9 |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.44 |
| IUPAC Name | 1-[3-[3-(1,5-dipropoxypentoxy)propoxymethoxymethoxy]propoxy]-1,5-dipropoxypentane |
| SMILES | CCCOCCCCC(OCCC)OCCCOCOCOCCCOC(CCCCOCCC)OCCC |
| InChI | InChI=1S/C30H62O9/c1-5-17-31-21-11-9-15-29(36-19-7-3)38-25-13-23-33-27-35-28-34-24-14-26-39-30(37-20-8-4)16-10-12-22-32-18-6-2/h29-30H,5-28H2,1-4H3 |
| InChIKey | AYQUZRPVPRGBMK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|