C16H34O2 — CID 54557001
1,1-dibutoxyoctane (PubChem CID 54557001) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 1,1-dibutoxyoctane.
| Compound Name | 1,1-dibutoxyoctane |
|---|---|
| PubChem CID | 54557001 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 1,1-dibutoxyoctane |
| SMILES | CCCCCCCC(OCCCC)OCCCC |
| InChI | InChI=1S/C16H34O2/c1-4-7-10-11-12-13-16(17-14-8-5-2)18-15-9-6-3/h16H,4-15H2,1-3H3 |
| InChIKey | YBUGVZUMUDEXJK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|