C20H42O4 — CID 139887225
1,1,4,4-tetrabutoxybutane (PubChem CID 139887225) has the molecular formula C20H42O4 and a molecular weight of 346.55 g/mol. Its IUPAC name is 1,1,4,4-tetrabutoxybutane.
| Compound Name | 1,1,4,4-tetrabutoxybutane |
|---|---|
| PubChem CID | 139887225 |
| Molecular Formula | C20H42O4 |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.31 |
| IUPAC Name | 1,1,4,4-tetrabutoxybutane |
| SMILES | CCCCOC(CCC(OCCCC)OCCCC)OCCCC |
| InChI | InChI=1S/C20H42O4/c1-5-9-15-21-19(22-16-10-6-2)13-14-20(23-17-11-7-3)24-18-12-8-4/h19-20H,5-18H2,1-4H3 |
| InChIKey | JNBHXABPKUUUDN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|