C28H62O4Si2 — CID 123229038
4,4-dibutoxybutyl-[4-(4,4-dibutoxybutylsilyl)butyl]silane (PubChem CID 123229038) has the molecular formula C28H62O4Si2 and a molecular weight of 518.97 g/mol. Its IUPAC name is 4,4-dibutoxybutyl-[4-(4,4-dibutoxybutylsilyl)butyl]silane.
| Compound Name | 4,4-dibutoxybutyl-[4-(4,4-dibutoxybutylsilyl)butyl]silane |
|---|---|
| PubChem CID | 123229038 |
| Molecular Formula | C28H62O4Si2 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.42 |
| IUPAC Name | 4,4-dibutoxybutyl-[4-(4,4-dibutoxybutylsilyl)butyl]silane |
| SMILES | CCCCOC(CCC[SiH2]CCCC[SiH2]CCCC(OCCCC)OCCCC)OCCCC |
| InChI | InChI=1S/C28H62O4Si2/c1-5-9-19-29-27(30-20-10-6-2)17-15-25-33-23-13-14-24-34-26-16-18-28(31-21-11-7-3)32-22-12-8-4/h27-28H,5-26,33-34H2,1-4H3 |
| InChIKey | BBRODDBBTGGSSM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|