C17H33N3O5Si — CID 172811673
1-[3-(3,3-dibutoxypropylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 172811673) has the molecular formula C17H33N3O5Si and a molecular weight of 387.55 g/mol. Its IUPAC name is 1-[3-(3,3-dibutoxypropylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[3-(3,3-dibutoxypropylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 172811673 |
| Molecular Formula | C17H33N3O5Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[3-(3,3-dibutoxypropylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCOC(CC[SiH2]CCCn1c(=O)[nH]c(=O)[nH]c1=O)OCCCC |
| InChI | InChI=1S/C17H33N3O5Si/c1-3-5-10-24-14(25-11-6-4-2)8-13-26-12-7-9-20-16(22)18-15(21)19-17(20)23/h14H,3-13,26H2,1-2H3,(H2,18,19,21,22,23) |
| InChIKey | SGJNYKIWUWPNAT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|