C10H15BrN4O4 — CID 141377585
2-bromo-7-(2,4,6-trioxo-1,3,5-triazinan-1-yl)heptanamide (PubChem CID 141377585) has the molecular formula C10H15BrN4O4 and a molecular weight of 335.16 g/mol. Its IUPAC name is 2-bromo-7-(2,4,6-trioxo-1,3,5-triazinan-1-yl)heptanamide.
| Compound Name | 2-bromo-7-(2,4,6-trioxo-1,3,5-triazinan-1-yl)heptanamide |
|---|---|
| PubChem CID | 141377585 |
| Molecular Formula | C10H15BrN4O4 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-bromo-7-(2,4,6-trioxo-1,3,5-triazinan-1-yl)heptanamide |
| SMILES | NC(=O)C(Br)CCCCCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15BrN4O4/c11-6(7(12)16)4-2-1-3-5-15-9(18)13-8(17)14-10(15)19/h6H,1-5H2,(H2,12,16)(H2,13,14,17,18,19) |
| InChIKey | YSWAJBOIFGQKMT-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|