C11H19N5O3 — CID 60702032
2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]propanamide (PubChem CID 60702032) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]propanamide.
| Compound Name | 2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]propanamide |
|---|---|
| PubChem CID | 60702032 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)amino]propanamide |
| SMILES | CCCCn1c(N)c(NC(C)C(N)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H19N5O3/c1-3-4-5-16-8(12)7(10(18)15-11(16)19)14-6(2)9(13)17/h6,14H,3-5,12H2,1-2H3,(H2,13,17)(H,15,18,19) |
| InChIKey | HEENULFHXHLRIC-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |